C9H10BrCl2N3O3S — CID 76929365
2-[(4-bromo-2,6-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide (PubChem CID 76929365) has the molecular formula C9H10BrCl2N3O3S and a molecular weight of 391.07 g/mol. Its IUPAC name is 2-[(4-bromo-2,6-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[(4-bromo-2,6-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 76929365 |
| Molecular Formula | C9H10BrCl2N3O3S |
| Molecular Weight | 391.07 g/mol |
| Exact Mass | 388.90 |
| IUPAC Name | 2-[(4-bromo-2,6-dichlorophenyl)sulfonyl-methylamino]-N'-hydroxyethanimidamide |
| SMILES | CN(CC(N)=NO)S(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C9H10BrCl2N3O3S/c1-15(4-8(13)14-16)19(17,18)9-6(11)2-5(10)3-7(9)12/h2-3,16H,4H2,1H3,(H2,13,14) |
| InChIKey | LFEGQQMAQOJRNP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.07 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|