C7H13F2NO4S — CID 60828136
2-[butan-2-yl(difluoromethylsulfonyl)amino]acetic acid (PubChem CID 60828136) has the molecular formula C7H13F2NO4S and a molecular weight of 245.25 g/mol. Its IUPAC name is 2-[butan-2-yl(difluoromethylsulfonyl)amino]acetic acid.
| Compound Name | 2-[butan-2-yl(difluoromethylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 60828136 |
| Molecular Formula | C7H13F2NO4S |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-[butan-2-yl(difluoromethylsulfonyl)amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H13F2NO4S/c1-3-5(2)10(4-6(11)12)15(13,14)7(8)9/h5,7H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | OCCDXNNMHXIQIJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |