C13H15NO — CID 608303
6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine (PubChem CID 608303) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine.
| Compound Name | 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine |
|---|---|
| PubChem CID | 608303 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine |
| SMILES | CCc1cc(-c2ccco2)c(C)c(C)n1 |
| InChI | InChI=1S/C13H15NO/c1-4-11-8-12(9(2)10(3)14-11)13-6-5-7-15-13/h5-8H,4H2,1-3H3 |
| InChIKey | DIWASMZWNWOPMD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |