About 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine
6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine (PubChem CID 608303) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine.
Molecular Properties
| Compound Name | 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine |
| PubChem CID | 608303 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine |
| SMILES | CCc1cc(-c2ccco2)c(C)c(C)n1 |
| InChI | InChI=1S/C13H15NO/c1-4-11-8-12(9(2)10(3)14-11)13-6-5-7-15-13/h5-8H,4H2,1-3H3 |
| InChIKey | DIWASMZWNWOPMD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine?
The IUPAC name of 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine (CID 608303) is 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine.
What is the SMILES notation for 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine?
The canonical SMILES for 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine is CCc1cc(-c2ccco2)c(C)c(C)n1.
What is the InChIKey of 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine?
The InChIKey is DIWASMZWNWOPMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c1-4-11-8-12(9(2)10(3)14-11)13-6-5-7-15-13/h5-8H,4H2,1-3H3.
What are the key properties of 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine?
6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine has a molecular weight of 201.27 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4-(furan-2-yl)-2,3-dimethylpyridine is sourced from PubChem (CID 608303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).