C14H18N6O — CID 60851422
2-piperazin-1-yl-N-[3-(1,2,4-triazol-4-yl)phenyl]acetamide (PubChem CID 60851422) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is 2-piperazin-1-yl-N-[3-(1,2,4-triazol-4-yl)phenyl]acetamide.
| Compound Name | 2-piperazin-1-yl-N-[3-(1,2,4-triazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 60851422 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-piperazin-1-yl-N-[3-(1,2,4-triazol-4-yl)phenyl]acetamide |
| SMILES | O=C(CN1CCNCC1)Nc1cccc(-n2cnnc2)c1 |
| InChI | InChI=1S/C14H18N6O/c21-14(9-19-6-4-15-5-7-19)18-12-2-1-3-13(8-12)20-10-16-17-11-20/h1-3,8,10-11,15H,4-7,9H2,(H,18,21) |
| InChIKey | GJVYTEKCAGKATP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |