C17H25N3S — CID 60868924
N'-cycloheptyl-N'-thieno[3,2-c]pyridin-4-ylpropane-1,3-diamine (PubChem CID 60868924) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is N'-cycloheptyl-N'-thieno[3,2-c]pyridin-4-ylpropane-1,3-diamine.
| Compound Name | N'-cycloheptyl-N'-thieno[3,2-c]pyridin-4-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 60868924 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N'-cycloheptyl-N'-thieno[3,2-c]pyridin-4-ylpropane-1,3-diamine |
| SMILES | NCCCN(c1nccc2sccc12)C1CCCCCC1 |
| InChI | InChI=1S/C17H25N3S/c18-10-5-12-20(14-6-3-1-2-4-7-14)17-15-9-13-21-16(15)8-11-19-17/h8-9,11,13-14H,1-7,10,12,18H2 |
| InChIKey | QGCGWPCZZRNGCQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |