C26H24BrN5O2 — CID 6088927
2-(7-bromo-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]acetamide (PubChem CID 6088927) has the molecular formula C26H24BrN5O2 and a molecular weight of 518.42 g/mol. Its IUPAC name is 2-(7-bromo-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(7-bromo-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6088927 |
| Molecular Formula | C26H24BrN5O2 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 2-(7-bromo-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)-N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]acetamide |
| SMILES | CN(C)c1ccc(/C=N\NC(=O)CN2C(=O)CN=C(c3ccccc3)c3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C26H24BrN5O2/c1-31(2)21-11-8-18(9-12-21)15-29-30-24(33)17-32-23-13-10-20(27)14-22(23)26(28-16-25(32)34)19-6-4-3-5-7-19/h3-15H,16-17H2,1-2H3,(H,30,33)/b29-15- |
| InChIKey | USPPNTSZNLLUEO-FDVSRXAVSA-N |
| XLogP | 3.85 |
| TPSA | 77.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|