C24H20N4O3 — CID 135777384
N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)acetamide (PubChem CID 135777384) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)acetamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)acetamide |
|---|---|
| PubChem CID | 135777384 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)CN=C(c2ccccc2)c2ccccc21)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C24H20N4O3/c29-21-13-7-4-10-18(21)14-26-27-22(30)16-28-20-12-6-5-11-19(20)24(25-15-23(28)31)17-8-2-1-3-9-17/h1-14,29H,15-16H2,(H,27,30)/b26-14+ |
| InChIKey | JUPAHEHBIZOYGK-VULFUBBASA-N |
| XLogP | 2.73 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|