C16H15Cl2NO — CID 60890207
[3,5-dichloro-2-[(E)-3-phenylprop-2-enoxy]phenyl]methanamine (PubChem CID 60890207) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is [3,5-dichloro-2-[(E)-3-phenylprop-2-enoxy]phenyl]methanamine.
| Compound Name | [3,5-dichloro-2-[(E)-3-phenylprop-2-enoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 60890207 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | [3,5-dichloro-2-[(E)-3-phenylprop-2-enoxy]phenyl]methanamine |
| SMILES | NCc1cc(Cl)cc(Cl)c1OC/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H15Cl2NO/c17-14-9-13(11-19)16(15(18)10-14)20-8-4-7-12-5-2-1-3-6-12/h1-7,9-10H,8,11,19H2/b7-4+ |
| InChIKey | BWZPBLCJJMMDKM-QPJJXVBHSA-N |
| XLogP | 4.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |