C16H13FN4O3S2 — CID 6092810
4-[(5E)-5-(benzoylhydrazinylidene)-4-methyl-1,3,4-thiadiazol-2-yl]benzenesulfonyl fluoride (PubChem CID 6092810) has the molecular formula C16H13FN4O3S2 and a molecular weight of 392.44 g/mol. Its IUPAC name is 4-[(5E)-5-(benzoylhydrazinylidene)-4-methyl-1,3,4-thiadiazol-2-yl]benzenesulfonyl fluoride.
| Compound Name | 4-[(5E)-5-(benzoylhydrazinylidene)-4-methyl-1,3,4-thiadiazol-2-yl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 6092810 |
| Molecular Formula | C16H13FN4O3S2 |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 4-[(5E)-5-(benzoylhydrazinylidene)-4-methyl-1,3,4-thiadiazol-2-yl]benzenesulfonyl fluoride |
| SMILES | Cn1nc(-c2ccc(S(=O)(=O)F)cc2)s/c1=N/NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13FN4O3S2/c1-21-16(19-18-14(22)11-5-3-2-4-6-11)25-15(20-21)12-7-9-13(10-8-12)26(17,23)24/h2-10H,1H3,(H,18,22)/b19-16+ |
| InChIKey | RHKQUDXMLWPWQT-KNTRCKAVSA-N |
| XLogP | 2.05 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|