C17H19N3S — CID 60932001
N-[cyclopentyl(thiophen-2-yl)methyl]-1H-indazol-4-amine (PubChem CID 60932001) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is N-[cyclopentyl(thiophen-2-yl)methyl]-1H-indazol-4-amine.
| Compound Name | N-[cyclopentyl(thiophen-2-yl)methyl]-1H-indazol-4-amine |
|---|---|
| PubChem CID | 60932001 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-[cyclopentyl(thiophen-2-yl)methyl]-1H-indazol-4-amine |
| SMILES | c1csc(C(Nc2cccc3[nH]ncc23)C2CCCC2)c1 |
| InChI | InChI=1S/C17H19N3S/c1-2-6-12(5-1)17(16-9-4-10-21-16)19-14-7-3-8-15-13(14)11-18-20-15/h3-4,7-12,17,19H,1-2,5-6H2,(H,18,20) |
| InChIKey | PGZMDPOPRCTPAP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |