C33H78O10Si7 — CID 609349
4-[6-methyl-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxy-2,3,5,6-tetrakis(trimethylsilyloxy)hexanal (PubChem CID 609349) has the molecular formula C33H78O10Si7 and a molecular weight of 831.58 g/mol. Its IUPAC name is 4-[6-methyl-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxy-2,3,5,6-tetrakis(trimethylsilyloxy)hexanal.
| Compound Name | 4-[6-methyl-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxy-2,3,5,6-tetrakis(trimethylsilyloxy)hexanal |
|---|---|
| PubChem CID | 609349 |
| Molecular Formula | C33H78O10Si7 |
| Molecular Weight | 831.58 g/mol |
| Exact Mass | 830.40 |
| IUPAC Name | 4-[6-methyl-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]oxy-2,3,5,6-tetrakis(trimethylsilyloxy)hexanal |
| SMILES | CC1OC(OC(C(CO[Si](C)(C)C)O[Si](C)(C)C)C(O[Si](C)(C)C)C(C=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C33H78O10Si7/c1-25-28(40-47(11,12)13)31(42-49(17,18)19)32(43-50(20,21)22)33(36-25)37-29(27(39-46(8,9)10)24-35-44(2,3)4)30(41-48(14,15)16)26(23-34)38-45(5,6)7/h23,25-33H,24H2,1-22H3 |
| InChIKey | GNUNVGXPMUAUIG-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.58 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|