C16H20ClNO — CID 60935728
N-(3-chloro-4-propoxyphenyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 60935728) has the molecular formula C16H20ClNO and a molecular weight of 277.80 g/mol. Its IUPAC name is N-(3-chloro-4-propoxyphenyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-(3-chloro-4-propoxyphenyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 60935728 |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(3-chloro-4-propoxyphenyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | CCCOc1ccc(NC2CC3CC=CC32)cc1Cl |
| InChI | InChI=1S/C16H20ClNO/c1-2-8-19-16-7-6-12(10-14(16)17)18-15-9-11-4-3-5-13(11)15/h3,5-7,10-11,13,15,18H,2,4,8-9H2,1H3 |
| InChIKey | BDXWVCCZMLHMED-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|