C9H12F3NO3 — CID 60949423
(E)-4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]but-2-enoic acid (PubChem CID 60949423) has the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. Its IUPAC name is (E)-4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 60949423 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (E)-4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]but-2-enoic acid |
| SMILES | CCCN(CC(F)(F)F)C(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C9H12F3NO3/c1-2-5-13(6-9(10,11)12)7(14)3-4-8(15)16/h3-4H,2,5-6H2,1H3,(H,15,16)/b4-3+ |
| InChIKey | KBCWFFKJEHELDF-ONEGZZNKSA-N |
| XLogP | 1.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|