C14H15FN2O3S — CID 60959573
N-[1-(2-fluorophenyl)ethyl]-N-methyl-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 60959573) has the molecular formula C14H15FN2O3S and a molecular weight of 310.35 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)ethyl]-N-methyl-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-[1-(2-fluorophenyl)ethyl]-N-methyl-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 60959573 |
| Molecular Formula | C14H15FN2O3S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-[1-(2-fluorophenyl)ethyl]-N-methyl-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CC(c1ccccc1F)N(C)S(=O)(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C14H15FN2O3S/c1-10(12-5-3-4-6-13(12)15)17(2)21(19,20)11-7-8-14(18)16-9-11/h3-10H,1-2H3,(H,16,18) |
| InChIKey | AXNIRQJALTVAOE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |