C19H15N3O6 — CID 6096809
7-[(2,5-dimethoxyphenyl)methyl]-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone (PubChem CID 6096809) has the molecular formula C19H15N3O6 and a molecular weight of 381.34 g/mol. Its IUPAC name is 7-[(2,5-dimethoxyphenyl)methyl]-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone.
| Compound Name | 7-[(2,5-dimethoxyphenyl)methyl]-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone |
|---|---|
| PubChem CID | 6096809 |
| Molecular Formula | C19H15N3O6 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 7-[(2,5-dimethoxyphenyl)methyl]-1,4-dihydropyrrolo[3,4-g]quinoxaline-5,6,8,9-tetrone |
| SMILES | COc1ccc(OC)c(Cn2c(=O)c3c(=O)c4[nH]cc[nH]c4c(=O)c3c2=O)c1 |
| InChI | InChI=1S/C19H15N3O6/c1-27-10-3-4-11(28-2)9(7-10)8-22-18(25)12-13(19(22)26)17(24)15-14(16(12)23)20-5-6-21-15/h3-7,20-21H,8H2,1-2H3 |
| InChIKey | GJRRLWFLZLRXBE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|