C11H6F2N2O4 — CID 60975191
1-(2,4-difluoro-5-nitrophenyl)-3-methylpyrrole-2,5-dione (PubChem CID 60975191) has the molecular formula C11H6F2N2O4 and a molecular weight of 268.18 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-nitrophenyl)-3-methylpyrrole-2,5-dione.
| Compound Name | 1-(2,4-difluoro-5-nitrophenyl)-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 60975191 |
| Molecular Formula | C11H6F2N2O4 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 1-(2,4-difluoro-5-nitrophenyl)-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(c2cc([N+](=O)[O-])c(F)cc2F)C1=O |
| InChI | InChI=1S/C11H6F2N2O4/c1-5-2-10(16)14(11(5)17)8-4-9(15(18)19)7(13)3-6(8)12/h2-4H,1H3 |
| InChIKey | CPEHBSWKSVMZLB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|