About 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide
4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide (PubChem CID 60979840) has the molecular formula C8H19N3O2
and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide |
| PubChem CID | 60979840 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide |
| SMILES | CCN(CCO)CCC/C(N)=N/O |
| InChI | InChI=1S/C8H19N3O2/c1-2-11(6-7-12)5-3-4-8(9)10-13/h12-13H,2-7H2,1H3,(H2,9,10) |
| InChIKey | JGQRGMQCXTZKET-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide?
The IUPAC name of 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide (CID 60979840) is 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide.
What is the SMILES notation for 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide?
The canonical SMILES for 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide is CCN(CCO)CCC/C(N)=N/O.
What is the InChIKey of 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide?
The InChIKey is JGQRGMQCXTZKET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N3O2/c1-2-11(6-7-12)5-3-4-8(9)10-13/h12-13H,2-7H2,1H3,(H2,9,10).
What are the key properties of 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide?
4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide has a molecular weight of 189.26 g/mol, XLogP of -0.17, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[ethyl(2-hydroxyethyl)amino]-N'-hydroxybutanimidamide is sourced from PubChem (CID 60979840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).