C12H10Cl2N6 — CID 60980340
N-[2-(2,4-dichlorophenyl)ethyl]tetrazolo[1,5-a]pyrazin-5-amine (PubChem CID 60980340) has the molecular formula C12H10Cl2N6 and a molecular weight of 309.16 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]tetrazolo[1,5-a]pyrazin-5-amine.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]tetrazolo[1,5-a]pyrazin-5-amine |
|---|---|
| PubChem CID | 60980340 |
| Molecular Formula | C12H10Cl2N6 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]tetrazolo[1,5-a]pyrazin-5-amine |
| SMILES | Clc1ccc(CCNc2cncc3nnnn23)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N6/c13-9-2-1-8(10(14)5-9)3-4-16-11-6-15-7-12-17-18-19-20(11)12/h1-2,5-7,16H,3-4H2 |
| InChIKey | VVTAJOHEMCHNPW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |