C11H9ClN6 — CID 60981108
N-[(4-chlorophenyl)methyl]tetrazolo[1,5-a]pyrazin-5-amine (PubChem CID 60981108) has the molecular formula C11H9ClN6 and a molecular weight of 260.69 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]tetrazolo[1,5-a]pyrazin-5-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]tetrazolo[1,5-a]pyrazin-5-amine |
|---|---|
| PubChem CID | 60981108 |
| Molecular Formula | C11H9ClN6 |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]tetrazolo[1,5-a]pyrazin-5-amine |
| SMILES | Clc1ccc(CNc2cncc3nnnn23)cc1 |
| InChI | InChI=1S/C11H9ClN6/c12-9-3-1-8(2-4-9)5-14-10-6-13-7-11-15-16-17-18(10)11/h1-4,6-7,14H,5H2 |
| InChIKey | JAADWBDVPNEFFH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |