About N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine
N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine (PubChem CID 103970438) has the molecular formula C12H19N7
and a molecular weight of 261.33 g/mol. Its IUPAC name is N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine.
Molecular Properties
| Compound Name | N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine |
| PubChem CID | 103970438 |
| Molecular Formula | C12H19N7 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine |
| SMILES | NCC1(CNc2cncc3nnnn23)CCCCC1 |
| InChI | InChI=1S/C12H19N7/c13-8-12(4-2-1-3-5-12)9-15-10-6-14-7-11-16-17-18-19(10)11/h6-7,15H,1-5,8-9,13H2 |
| InChIKey | ZMCOCSJVOBJEFW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine?
The IUPAC name of N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine (CID 103970438) is N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine.
What is the SMILES notation for N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine?
The canonical SMILES for N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine is NCC1(CNc2cncc3nnnn23)CCCCC1.
What is the InChIKey of N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine?
The InChIKey is ZMCOCSJVOBJEFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N7/c13-8-12(4-2-1-3-5-12)9-15-10-6-14-7-11-16-17-18-19(10)11/h6-7,15H,1-5,8-9,13H2.
What are the key properties of N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine?
N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine has a molecular weight of 261.33 g/mol, XLogP of 0.84, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(aminomethyl)cyclohexyl]methyl]tetrazolo[1,5-a]pyrazin-5-amine is sourced from PubChem (CID 103970438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).