C9H12N6O — CID 60980439
N-(oxolan-2-ylmethyl)tetrazolo[1,5-a]pyrazin-5-amine (PubChem CID 60980439) has the molecular formula C9H12N6O and a molecular weight of 220.24 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)tetrazolo[1,5-a]pyrazin-5-amine.
| Compound Name | N-(oxolan-2-ylmethyl)tetrazolo[1,5-a]pyrazin-5-amine |
|---|---|
| PubChem CID | 60980439 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | N-(oxolan-2-ylmethyl)tetrazolo[1,5-a]pyrazin-5-amine |
| SMILES | c1ncc2nnnn2c1NCC1CCCO1 |
| InChI | InChI=1S/C9H12N6O/c1-2-7(16-3-1)4-11-8-5-10-6-9-12-13-14-15(8)9/h5-7,11H,1-4H2 |
| InChIKey | TZFMIWOZDIUYGC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |