C6H11ClN4O2S — CID 60982074
3-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)propane-1-sulfonamide (PubChem CID 60982074) has the molecular formula C6H11ClN4O2S and a molecular weight of 238.70 g/mol. Its IUPAC name is 3-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 60982074 |
| Molecular Formula | C6H11ClN4O2S |
| Molecular Weight | 238.70 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 3-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NCc1ncn[nH]1 |
| InChI | InChI=1S/C6H11ClN4O2S/c7-2-1-3-14(12,13)10-4-6-8-5-9-11-6/h5,10H,1-4H2,(H,8,9,11) |
| InChIKey | HSSIGHJPEZYXFP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.70 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|