C13H19NO3 — CID 609958
7,8,9-trimethoxy-2,3,4,5-tetrahydro-1H-2-benzazepine (PubChem CID 609958) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 7,8,9-trimethoxy-2,3,4,5-tetrahydro-1H-2-benzazepine.
| Compound Name | 7,8,9-trimethoxy-2,3,4,5-tetrahydro-1H-2-benzazepine |
|---|---|
| PubChem CID | 609958 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 7,8,9-trimethoxy-2,3,4,5-tetrahydro-1H-2-benzazepine |
| SMILES | COc1cc2c(c(OC)c1OC)CNCCC2 |
| InChI | InChI=1S/C13H19NO3/c1-15-11-7-9-5-4-6-14-8-10(9)12(16-2)13(11)17-3/h7,14H,4-6,8H2,1-3H3 |
| InChIKey | IYTHYJMIIFLWGL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |