C12H18N6O2 — CID 61000399
6-amino-1-butyl-5-(1H-pyrazol-4-ylmethylamino)pyrimidine-2,4-dione (PubChem CID 61000399) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is 6-amino-1-butyl-5-(1H-pyrazol-4-ylmethylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-butyl-5-(1H-pyrazol-4-ylmethylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 61000399 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 6-amino-1-butyl-5-(1H-pyrazol-4-ylmethylamino)pyrimidine-2,4-dione |
| SMILES | CCCCn1c(N)c(NCc2cn[nH]c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H18N6O2/c1-2-3-4-18-10(13)9(11(19)17-12(18)20)14-5-8-6-15-16-7-8/h6-7,14H,2-5,13H2,1H3,(H,15,16)(H,17,19,20) |
| InChIKey | IZPWBOLALTZNAL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |