C8H10N4O3 — CID 61004542
(E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]-4-oxobut-2-enoic acid (PubChem CID 61004542) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 61004542 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (E)-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]-4-oxobut-2-enoic acid |
| SMILES | Cn1cnnc1CNC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C8H10N4O3/c1-12-5-10-11-6(12)4-9-7(13)2-3-8(14)15/h2-3,5H,4H2,1H3,(H,9,13)(H,14,15)/b3-2+ |
| InChIKey | YXPSMLBXYZMOAM-NSCUHMNNSA-N |
| XLogP | -0.93 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|