C11H13N5O2S — CID 610046
7-ethyl-8-(isothiocyanatomethyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 610046) has the molecular formula C11H13N5O2S and a molecular weight of 279.32 g/mol. Its IUPAC name is 7-ethyl-8-(isothiocyanatomethyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-ethyl-8-(isothiocyanatomethyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 610046 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 7-ethyl-8-(isothiocyanatomethyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | CCn1c(CN=C=S)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C11H13N5O2S/c1-4-16-7(5-12-6-19)13-9-8(16)10(17)15(3)11(18)14(9)2/h4-5H2,1-3H3 |
| InChIKey | OKQHPTHZOPWENY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 74.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|