C12H18N4O3S — CID 135319068
7-ethyl-1,3-dimethyl-8-propylsulfinylpurine-2,6-dione (PubChem CID 135319068) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is 7-ethyl-1,3-dimethyl-8-propylsulfinylpurine-2,6-dione.
| Compound Name | 7-ethyl-1,3-dimethyl-8-propylsulfinylpurine-2,6-dione |
|---|---|
| PubChem CID | 135319068 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 7-ethyl-1,3-dimethyl-8-propylsulfinylpurine-2,6-dione |
| SMILES | CCCS(=O)c1nc2c(c(=O)n(C)c(=O)n2C)n1CC |
| InChI | InChI=1S/C12H18N4O3S/c1-5-7-20(19)11-13-9-8(16(11)6-2)10(17)15(4)12(18)14(9)3/h5-7H2,1-4H3 |
| InChIKey | KOXYATYLQXIGBA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |