C15H20F3N3 — CID 61011927
N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 61011927) has the molecular formula C15H20F3N3 and a molecular weight of 299.34 g/mol. Its IUPAC name is N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 61011927 |
| Molecular Formula | C15H20F3N3 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CN1C2CCC1CC(CNc1ncccc1C(F)(F)F)C2 |
| InChI | InChI=1S/C15H20F3N3/c1-21-11-4-5-12(21)8-10(7-11)9-20-14-13(15(16,17)18)3-2-6-19-14/h2-3,6,10-12H,4-5,7-9H2,1H3,(H,19,20) |
| InChIKey | MPGRRZNGCFKVDF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |