C24H29N2O6P — CID 6104632
N-[(Z)-1-diethoxyphosphoryl-3-morpholin-4-yl-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 6104632) has the molecular formula C24H29N2O6P and a molecular weight of 472.48 g/mol. Its IUPAC name is N-[(Z)-1-diethoxyphosphoryl-3-morpholin-4-yl-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-diethoxyphosphoryl-3-morpholin-4-yl-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6104632 |
| Molecular Formula | C24H29N2O6P |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-[(Z)-1-diethoxyphosphoryl-3-morpholin-4-yl-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | CCOP(=O)(OCC)/C(=C(\NC(=O)c1ccccc1)C(=O)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C24H29N2O6P/c1-3-31-33(29,32-4-2)22(19-11-7-5-8-12-19)21(24(28)26-15-17-30-18-16-26)25-23(27)20-13-9-6-10-14-20/h5-14H,3-4,15-18H2,1-2H3,(H,25,27)/b22-21- |
| InChIKey | RZLZZHYOKRYADJ-DQRAZIAOSA-N |
| XLogP | 3.91 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|