C18H27N2O4P — CID 2829765
N-[(Z)-1-diethoxyphosphoryl-2-piperidin-1-ylethenyl]benzamide (PubChem CID 2829765) has the molecular formula C18H27N2O4P and a molecular weight of 366.40 g/mol. Its IUPAC name is N-[(Z)-1-diethoxyphosphoryl-2-piperidin-1-ylethenyl]benzamide.
| Compound Name | N-[(Z)-1-diethoxyphosphoryl-2-piperidin-1-ylethenyl]benzamide |
|---|---|
| PubChem CID | 2829765 |
| Molecular Formula | C18H27N2O4P |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[(Z)-1-diethoxyphosphoryl-2-piperidin-1-ylethenyl]benzamide |
| SMILES | CCOP(=O)(OCC)/C(=C\N1CCCCC1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H27N2O4P/c1-3-23-25(22,24-4-2)17(15-20-13-9-6-10-14-20)19-18(21)16-11-7-5-8-12-16/h5,7-8,11-12,15H,3-4,6,9-10,13-14H2,1-2H3,(H,19,21)/b17-15- |
| InChIKey | GXKUAJBUNCEGNK-ICFOKQHNSA-N |
| XLogP | 3.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|