C24H25N4O5P — CID 2308943
N-[(Z)-1-diethoxyphosphoryl-3-oxo-1-phenyl-3-(pyrimidin-2-ylamino)prop-1-en-2-yl]benzamide (PubChem CID 2308943) has the molecular formula C24H25N4O5P and a molecular weight of 480.46 g/mol. Its IUPAC name is N-[(Z)-1-diethoxyphosphoryl-3-oxo-1-phenyl-3-(pyrimidin-2-ylamino)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-diethoxyphosphoryl-3-oxo-1-phenyl-3-(pyrimidin-2-ylamino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 2308943 |
| Molecular Formula | C24H25N4O5P |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-[(Z)-1-diethoxyphosphoryl-3-oxo-1-phenyl-3-(pyrimidin-2-ylamino)prop-1-en-2-yl]benzamide |
| SMILES | CCOP(=O)(OCC)/C(=C(\NC(=O)c1ccccc1)C(=O)Nc1ncccn1)c1ccccc1 |
| InChI | InChI=1S/C24H25N4O5P/c1-3-32-34(31,33-4-2)21(18-12-7-5-8-13-18)20(23(30)28-24-25-16-11-17-26-24)27-22(29)19-14-9-6-10-15-19/h5-17H,3-4H2,1-2H3,(H,27,29)(H,25,26,28,30)/b21-20- |
| InChIKey | BJPDAPYBJPBFED-MRCUWXFGSA-N |
| XLogP | 4.48 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|