C17H18ClNO — CID 61047502
2-anilino-2-(4-chlorophenyl)-2-cyclopropylethanol (PubChem CID 61047502) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is 2-anilino-2-(4-chlorophenyl)-2-cyclopropylethanol.
| Compound Name | 2-anilino-2-(4-chlorophenyl)-2-cyclopropylethanol |
|---|---|
| PubChem CID | 61047502 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-anilino-2-(4-chlorophenyl)-2-cyclopropylethanol |
| SMILES | OCC(Nc1ccccc1)(c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C17H18ClNO/c18-15-10-8-14(9-11-15)17(12-20,13-6-7-13)19-16-4-2-1-3-5-16/h1-5,8-11,13,19-20H,6-7,12H2 |
| InChIKey | ATGYGJIENBKRLH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |