C17H17ClFNO — CID 61049500
2-(4-chlorophenyl)-2-cyclopropyl-2-(3-fluoroanilino)ethanol (PubChem CID 61049500) has the molecular formula C17H17ClFNO and a molecular weight of 305.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-cyclopropyl-2-(3-fluoroanilino)ethanol.
| Compound Name | 2-(4-chlorophenyl)-2-cyclopropyl-2-(3-fluoroanilino)ethanol |
|---|---|
| PubChem CID | 61049500 |
| Molecular Formula | C17H17ClFNO |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-(4-chlorophenyl)-2-cyclopropyl-2-(3-fluoroanilino)ethanol |
| SMILES | OCC(Nc1cccc(F)c1)(c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C17H17ClFNO/c18-14-8-6-13(7-9-14)17(11-21,12-4-5-12)20-16-3-1-2-15(19)10-16/h1-3,6-10,12,20-21H,4-5,11H2 |
| InChIKey | ZHZUDZQFQRXPFU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |