C18H20ClNO — CID 61048389
2-(4-chlorophenyl)-2-cyclopropyl-2-(3-methylanilino)ethanol (PubChem CID 61048389) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-cyclopropyl-2-(3-methylanilino)ethanol.
| Compound Name | 2-(4-chlorophenyl)-2-cyclopropyl-2-(3-methylanilino)ethanol |
|---|---|
| PubChem CID | 61048389 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-(4-chlorophenyl)-2-cyclopropyl-2-(3-methylanilino)ethanol |
| SMILES | Cc1cccc(NC(CO)(c2ccc(Cl)cc2)C2CC2)c1 |
| InChI | InChI=1S/C18H20ClNO/c1-13-3-2-4-17(11-13)20-18(12-21,14-5-6-14)15-7-9-16(19)10-8-15/h2-4,7-11,14,20-21H,5-6,12H2,1H3 |
| InChIKey | ASGDBRDIQVZGQH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |