C12H5Cl3N4OS — CID 61053149
2-chloro-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)pyridine-4-carboxamide (PubChem CID 61053149) has the molecular formula C12H5Cl3N4OS and a molecular weight of 359.63 g/mol. Its IUPAC name is 2-chloro-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 61053149 |
| Molecular Formula | C12H5Cl3N4OS |
| Molecular Weight | 359.63 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | 2-chloro-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1c(Cl)cc(Cl)c2nsnc12)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C12H5Cl3N4OS/c13-6-4-7(14)10-11(19-21-18-10)9(6)17-12(20)5-1-2-16-8(15)3-5/h1-4H,(H,17,20) |
| InChIKey | LNGXANWWTIJCIH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|