C14H16BrNO2S2 — CID 61068609
3-bromo-N-[1-(2,4-dimethylphenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 61068609) has the molecular formula C14H16BrNO2S2 and a molecular weight of 374.33 g/mol. Its IUPAC name is 3-bromo-N-[1-(2,4-dimethylphenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-[1-(2,4-dimethylphenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61068609 |
| Molecular Formula | C14H16BrNO2S2 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 3-bromo-N-[1-(2,4-dimethylphenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(C(C)NS(=O)(=O)c2sccc2Br)c(C)c1 |
| InChI | InChI=1S/C14H16BrNO2S2/c1-9-4-5-12(10(2)8-9)11(3)16-20(17,18)14-13(15)6-7-19-14/h4-8,11,16H,1-3H3 |
| InChIKey | MJNYBTLAENTVJX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |