C9H13BrClNO2S2 — CID 79268179
3-bromo-N-(1-chloro-3-methylbutan-2-yl)thiophene-2-sulfonamide (PubChem CID 79268179) has the molecular formula C9H13BrClNO2S2 and a molecular weight of 346.70 g/mol. Its IUPAC name is 3-bromo-N-(1-chloro-3-methylbutan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-(1-chloro-3-methylbutan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79268179 |
| Molecular Formula | C9H13BrClNO2S2 |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 344.93 |
| IUPAC Name | 3-bromo-N-(1-chloro-3-methylbutan-2-yl)thiophene-2-sulfonamide |
| SMILES | CC(C)C(CCl)NS(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C9H13BrClNO2S2/c1-6(2)8(5-11)12-16(13,14)9-7(10)3-4-15-9/h3-4,6,8,12H,5H2,1-2H3 |
| InChIKey | ZPCZQVKTEGHUSJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|