C15H19Br2N3O — CID 61071467
N-[(3,5-dibromo-2-methoxyphenyl)methyl]-4-imidazol-1-ylbutan-1-amine (PubChem CID 61071467) has the molecular formula C15H19Br2N3O and a molecular weight of 417.15 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-methoxyphenyl)methyl]-4-imidazol-1-ylbutan-1-amine.
| Compound Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-4-imidazol-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 61071467 |
| Molecular Formula | C15H19Br2N3O |
| Molecular Weight | 417.15 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-4-imidazol-1-ylbutan-1-amine |
| SMILES | COc1c(Br)cc(Br)cc1CNCCCCn1ccnc1 |
| InChI | InChI=1S/C15H19Br2N3O/c1-21-15-12(8-13(16)9-14(15)17)10-18-4-2-3-6-20-7-5-19-11-20/h5,7-9,11,18H,2-4,6,10H2,1H3 |
| InChIKey | CPEDKSWNYLITAU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|