C8H4ClF2N3S — CID 61075065
4-chloro-N-(2,3-difluorophenyl)-1,2,5-thiadiazol-3-amine (PubChem CID 61075065) has the molecular formula C8H4ClF2N3S and a molecular weight of 247.66 g/mol. Its IUPAC name is 4-chloro-N-(2,3-difluorophenyl)-1,2,5-thiadiazol-3-amine.
| Compound Name | 4-chloro-N-(2,3-difluorophenyl)-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 61075065 |
| Molecular Formula | C8H4ClF2N3S |
| Molecular Weight | 247.66 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 4-chloro-N-(2,3-difluorophenyl)-1,2,5-thiadiazol-3-amine |
| SMILES | Fc1cccc(Nc2nsnc2Cl)c1F |
| InChI | InChI=1S/C8H4ClF2N3S/c9-7-8(14-15-13-7)12-5-3-1-2-4(10)6(5)11/h1-3H,(H,12,14) |
| InChIKey | LPENUMKFKOYZGE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.66 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |