2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid

C9H6F2N4O2S — CID 61075946

IUPAC2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid
SMILESO=C(O)CSc1nnnn1-c1cccc(F)c1F
InChIInChI=1S/C9H6F2N4O2S/c10-5-2-1-3-6(8(5)11)15-9(12-13-14-15)18-4-7(16)17/h1-3H,4H2,(H,16,17)
InChIKeyUZGJFVVUKBHAFV-UHFFFAOYSA-N
MW272.24 g/mol
LogP1.12
Rot. Bonds4

About 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid

2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid (PubChem CID 61075946) has the molecular formula C9H6F2N4O2S and a molecular weight of 272.24 g/mol. Its IUPAC name is 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid.

Molecular Properties

Compound Name2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid
PubChem CID61075946
Molecular FormulaC9H6F2N4O2S
Molecular Weight272.24 g/mol
Exact Mass272.02
IUPAC Name2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid
SMILESO=C(O)CSc1nnnn1-c1cccc(F)c1F
InChIInChI=1S/C9H6F2N4O2S/c10-5-2-1-3-6(8(5)11)15-9(12-13-14-15)18-4-7(16)17/h1-3H,4H2,(H,16,17)
InChIKeyUZGJFVVUKBHAFV-UHFFFAOYSA-N
XLogP1.12
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.24
LogP ≤ 51.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid?
The IUPAC name of 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid (CID 61075946) is 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid.
What is the SMILES notation for 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid?
The canonical SMILES for 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid is O=C(O)CSc1nnnn1-c1cccc(F)c1F.
What is the InChIKey of 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid?
The InChIKey is UZGJFVVUKBHAFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2N4O2S/c10-5-2-1-3-6(8(5)11)15-9(12-13-14-15)18-4-7(16)17/h1-3H,4H2,(H,16,17).
What are the key properties of 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid?
2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid has a molecular weight of 272.24 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid is sourced from PubChem (CID 61075946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).