C9H6F2N4O2S — CID 61075946
2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid (PubChem CID 61075946) has the molecular formula C9H6F2N4O2S and a molecular weight of 272.24 g/mol. Its IUPAC name is 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 61075946 |
| Molecular Formula | C9H6F2N4O2S |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-[1-(2,3-difluorophenyl)tetrazol-5-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nnnn1-c1cccc(F)c1F |
| InChI | InChI=1S/C9H6F2N4O2S/c10-5-2-1-3-6(8(5)11)15-9(12-13-14-15)18-4-7(16)17/h1-3H,4H2,(H,16,17) |
| InChIKey | UZGJFVVUKBHAFV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |