C10H8F2N4O2S2 — CID 29070421
2-[1-[2-(difluoromethylsulfanyl)phenyl]tetrazol-5-yl]sulfanylacetic acid (PubChem CID 29070421) has the molecular formula C10H8F2N4O2S2 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-[1-[2-(difluoromethylsulfanyl)phenyl]tetrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-[2-(difluoromethylsulfanyl)phenyl]tetrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 29070421 |
| Molecular Formula | C10H8F2N4O2S2 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2-[1-[2-(difluoromethylsulfanyl)phenyl]tetrazol-5-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nnnn1-c1ccccc1SC(F)F |
| InChI | InChI=1S/C10H8F2N4O2S2/c11-9(12)20-7-4-2-1-3-6(7)16-10(13-14-15-16)19-5-8(17)18/h1-4,9H,5H2,(H,17,18) |
| InChIKey | MBBPWSQXGJCCHV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |