C9H12Br2OS — CID 61080480
1-(2,5-dibromothiophen-3-yl)-2-methylbutan-1-ol (PubChem CID 61080480) has the molecular formula C9H12Br2OS and a molecular weight of 328.07 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-methylbutan-1-ol.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 61080480 |
| Molecular Formula | C9H12Br2OS |
| Molecular Weight | 328.07 g/mol |
| Exact Mass | 325.90 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-methylbutan-1-ol |
| SMILES | CCC(C)C(O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H12Br2OS/c1-3-5(2)8(12)6-4-7(10)13-9(6)11/h4-5,8,12H,3H2,1-2H3 |
| InChIKey | XTLNLCSUPFRNIC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.07 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |