C8H10Br2OS — CID 61080667
1-(2,5-dibromothiophen-3-yl)butan-1-ol (PubChem CID 61080667) has the molecular formula C8H10Br2OS and a molecular weight of 314.04 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)butan-1-ol.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)butan-1-ol |
|---|---|
| PubChem CID | 61080667 |
| Molecular Formula | C8H10Br2OS |
| Molecular Weight | 314.04 g/mol |
| Exact Mass | 311.88 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)butan-1-ol |
| SMILES | CCCC(O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C8H10Br2OS/c1-2-3-6(11)5-4-7(9)12-8(5)10/h4,6,11H,2-3H2,1H3 |
| InChIKey | SQVIDCZTOVZZGB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.04 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |