C16H19N3OS — CID 61110583
(4-amino-1-cyclopropylpyrrol-2-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone (PubChem CID 61110583) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is (4-amino-1-cyclopropylpyrrol-2-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | (4-amino-1-cyclopropylpyrrol-2-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 61110583 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (4-amino-1-cyclopropylpyrrol-2-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
| SMILES | Nc1cc(C(=O)N2CCCC2c2ccsc2)n(C2CC2)c1 |
| InChI | InChI=1S/C16H19N3OS/c17-12-8-15(19(9-12)13-3-4-13)16(20)18-6-1-2-14(18)11-5-7-21-10-11/h5,7-10,13-14H,1-4,6,17H2 |
| InChIKey | JHJVFSIFDJELPL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |