C10H18N4O3S — CID 61114804
3-amino-1-ethyl-N-(oxolan-3-ylmethyl)pyrazole-4-sulfonamide (PubChem CID 61114804) has the molecular formula C10H18N4O3S and a molecular weight of 274.35 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-(oxolan-3-ylmethyl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-(oxolan-3-ylmethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61114804 |
| Molecular Formula | C10H18N4O3S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-amino-1-ethyl-N-(oxolan-3-ylmethyl)pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCC2CCOC2)c(N)n1 |
| InChI | InChI=1S/C10H18N4O3S/c1-2-14-6-9(10(11)13-14)18(15,16)12-5-8-3-4-17-7-8/h6,8,12H,2-5,7H2,1H3,(H2,11,13) |
| InChIKey | ADXGONYIYGYVLJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |