C11H20N2O7S — CID 61153628
(2S)-2-[2-(propylsulfonylamino)propanoylamino]pentanedioic acid (PubChem CID 61153628) has the molecular formula C11H20N2O7S and a molecular weight of 324.36 g/mol. Its IUPAC name is (2S)-2-[2-(propylsulfonylamino)propanoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[2-(propylsulfonylamino)propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 61153628 |
| Molecular Formula | C11H20N2O7S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (2S)-2-[2-(propylsulfonylamino)propanoylamino]pentanedioic acid |
| SMILES | CCCS(=O)(=O)NC(C)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N2O7S/c1-3-6-21(19,20)13-7(2)10(16)12-8(11(17)18)4-5-9(14)15/h7-8,13H,3-6H2,1-2H3,(H,12,16)(H,14,15)(H,17,18)/t7?,8-/m0/s1 |
| InChIKey | JLTBERFCZKOSJG-MQWKRIRWSA-N |
| XLogP | -0.86 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |