C13H14N2O2S — CID 61168858
2,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-benzodioxol-5-amine (PubChem CID 61168858) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 61168858 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-benzodioxol-5-amine |
| SMILES | CC1(C)Oc2ccc(NCc3cscn3)cc2O1 |
| InChI | InChI=1S/C13H14N2O2S/c1-13(2)16-11-4-3-9(5-12(11)17-13)14-6-10-7-18-8-15-10/h3-5,7-8,14H,6H2,1-2H3 |
| InChIKey | UXDAPOJOWSVIBR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|