C15H20N2O4 — CID 61226258
N-(cyanomethyl)-2,3,4-trimethoxy-N-propylbenzamide (PubChem CID 61226258) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-(cyanomethyl)-2,3,4-trimethoxy-N-propylbenzamide.
| Compound Name | N-(cyanomethyl)-2,3,4-trimethoxy-N-propylbenzamide |
|---|---|
| PubChem CID | 61226258 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-(cyanomethyl)-2,3,4-trimethoxy-N-propylbenzamide |
| SMILES | CCCN(CC#N)C(=O)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C15H20N2O4/c1-5-9-17(10-8-16)15(18)11-6-7-12(19-2)14(21-4)13(11)20-3/h6-7H,5,9-10H2,1-4H3 |
| InChIKey | RPNAUGQDPVXSEF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|