C17H38O7Si3 — CID 612379
methyl 2-[5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetate (PubChem CID 612379) has the molecular formula C17H38O7Si3 and a molecular weight of 438.74 g/mol. Its IUPAC name is methyl 2-[5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetate.
| Compound Name | methyl 2-[5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetate |
|---|---|
| PubChem CID | 612379 |
| Molecular Formula | C17H38O7Si3 |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | methyl 2-[5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetate |
| SMILES | COC(=O)C(O[Si](C)(C)C)C1OC(OC)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C17H38O7Si3/c1-19-16(18)14(23-26(6,7)8)12-13(22-25(3,4)5)15(17(20-2)21-12)24-27(9,10)11/h12-15,17H,1-11H3 |
| InChIKey | PUYBWLWFNZAWFM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|