C12H18ClN3O3S — CID 61254178
N-(5-chloro-2-ethoxyphenyl)piperazine-1-sulfonamide (PubChem CID 61254178) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is N-(5-chloro-2-ethoxyphenyl)piperazine-1-sulfonamide.
| Compound Name | N-(5-chloro-2-ethoxyphenyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61254178 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-(5-chloro-2-ethoxyphenyl)piperazine-1-sulfonamide |
| SMILES | CCOc1ccc(Cl)cc1NS(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C12H18ClN3O3S/c1-2-19-12-4-3-10(13)9-11(12)15-20(17,18)16-7-5-14-6-8-16/h3-4,9,14-15H,2,5-8H2,1H3 |
| InChIKey | OPBLNNIWWIPNCF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |